CAS 1338222-73-3
:1,1-Dimethylethyl N-[1-(2-methoxyphenyl)-1-methylethyl]carbamate
Description:
1,1-Dimethylethyl N-[1-(2-methoxyphenyl)-1-methylethyl]carbamate, identified by its CAS number 1338222-73-3, is a chemical compound that belongs to the class of carbamates. This substance features a complex structure characterized by a tert-butyl group (1,1-dimethylethyl) and a substituted phenyl moiety, which contributes to its potential biological activity. Carbamates are known for their applications in agriculture, particularly as pesticides and herbicides, due to their ability to inhibit certain enzymes in pests. The presence of the methoxyphenyl group may enhance its lipophilicity and influence its interaction with biological targets. Physically, compounds of this nature can exhibit varying solubility in organic solvents and may have specific melting and boiling points, which are essential for their handling and application. Additionally, the compound's stability, reactivity, and potential toxicity are critical factors that determine its use in various fields, including pharmaceuticals and agrochemicals. As with all chemical substances, proper safety measures should be observed when handling this compound.
Formula:C15H23NO3
InChI:InChI=1S/C15H23NO3/c1-14(2,3)19-13(17)16-15(4,5)11-9-7-8-10-12(11)18-6/h7-10H,1-6H3,(H,16,17)
InChI key:InChIKey=GIJBASGVOVWEJD-UHFFFAOYSA-N
SMILES:C(NC(OC(C)(C)C)=O)(C)(C)C1=C(OC)C=CC=C1
Synonyms:- Carbamic acid, N-[1-(2-methoxyphenyl)-1-methylethyl]-, 1,1-dimethylethyl ester
- 1,1-Dimethylethyl N-[1-(2-methoxyphenyl)-1-methylethyl]carbamate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
α,α-Dimethyl-2-methoxybenzylamine, N-BOC protected
CAS:α,α-Dimethyl-2-methoxybenzylamine, N-BOC protectedMolecular weight:265.35g/mol

