CAS 1338247-35-0: Propanamide, N-[5-[1-(2,6-dichlorophenyl)-3-(difluoromethyl)-1H-pyrazol-5-yl]-2-thiazolyl]-2-methyl-
Description:Propanamide, N-[5-[1-(2,6-dichlorophenyl)-3-(difluoromethyl)-1H-pyrazol-5-yl]-2-thiazolyl]-2-methyl- is a synthetic organic compound characterized by its complex structure, which includes a propanamide functional group, a thiazole ring, and a pyrazole moiety. The presence of the 2,6-dichlorophenyl group and difluoromethyl substituent contributes to its unique chemical properties and potential biological activity. This compound may exhibit specific interactions with biological targets, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential applications in areas such as agrochemicals or pharmaceuticals, particularly in the development of compounds with anti-inflammatory or anti-cancer properties. The compound's solubility, stability, and reactivity would depend on its specific functional groups and overall molecular configuration. As with many synthetic compounds, safety and handling precautions are essential due to potential toxicity or environmental impact. Further studies would be necessary to fully elucidate its properties and applications.
Formula:C17H14Cl2F2N4OS
InChI:InChI=1S/C17H14Cl2F2N4OS/c1-8(2)16(26)23-17-22-7-13(27-17)12-6-11(15(20)21)24-25(12)14-9(18)4-3-5-10(14)19/h3-8,15H,1-2H3,(H,22,23,26)
InChI key:InChIKey=IVUGBSGLHRJSSP-UHFFFAOYSA-N
SMILES:O=C(NC1=NC=C(S1)C2=CC(=NN2C=3C(Cl)=CC=CC3Cl)C(F)F)C(C)C
- Synonyms:
- Propanamide, N-[5-[1-(2,6-dichlorophenyl)-3-(difluoromethyl)-1H-pyrazol-5-yl]-2-thiazolyl]-2-methyl-
- BMS 5
![Propanamide, N-[5-[1-(2,6-dichlorophenyl)-3-(difluoromethyl)-1H-pyrazol-5-yl]-2-thiazolyl]-2-methy…](https://static.cymitquimica.com/cas-image/304621-propanamide-n-5-1-26-dichlorophenyl-3-difluoromethyl-1h-pyrazol-5-yl-2-thiazolyl-2-methyl.png)
