CAS 1338247-35-0
:Propanamide, N-[5-[1-(2,6-dichlorophenyl)-3-(difluoromethyl)-1H-pyrazol-5-yl]-2-thiazolyl]-2-methyl-
Description:
Propanamide, N-[5-[1-(2,6-dichlorophenyl)-3-(difluoromethyl)-1H-pyrazol-5-yl]-2-thiazolyl]-2-methyl- is a synthetic organic compound characterized by its complex structure, which includes a propanamide functional group, a thiazole ring, and a pyrazole moiety. The presence of the 2,6-dichlorophenyl group and difluoromethyl substituent contributes to its unique chemical properties and potential biological activity. This compound may exhibit specific interactions with biological targets, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential applications in areas such as agrochemicals or pharmaceuticals, particularly in the development of compounds with anti-inflammatory or anti-cancer properties. The compound's solubility, stability, and reactivity would depend on its specific functional groups and overall molecular configuration. As with many synthetic compounds, safety and handling precautions are essential due to potential toxicity or environmental impact. Further studies would be necessary to fully elucidate its properties and applications.
Formula:C17H14Cl2F2N4OS
InChI:InChI=1S/C17H14Cl2F2N4OS/c1-8(2)16(26)23-17-22-7-13(27-17)12-6-11(15(20)21)24-25(12)14-9(18)4-3-5-10(14)19/h3-8,15H,1-2H3,(H,22,23,26)
InChI key:InChIKey=IVUGBSGLHRJSSP-UHFFFAOYSA-N
SMILES:ClC1=C(N2C(=CC(C(F)F)=N2)C=3SC(NC(C(C)C)=O)=NC3)C(Cl)=CC=C1
Synonyms:- Propanamide, N-[5-[1-(2,6-dichlorophenyl)-3-(difluoromethyl)-1H-pyrazol-5-yl]-2-thiazolyl]-2-methyl-
- BMS 5
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
N-(5-(1-(2,6-Dichlorophenyl)-3-(difluoromethyl)-1H-pyrazol-5-yl)thiazol-2-yl)isobutyramide
CAS:Formula:C17H14Cl2F2N4OSPurity:98%Color and Shape:SolidMolecular weight:431.2871BMS-5
CAS:BMS-5 (LIMKi 3) is a potent LIMK inhibitor with IC50s of 7 nM and 8 nM for LIMK1 and LIMK2, respectively.Formula:C17H14Cl2F2N4OSPurity:98.01% - 99.88%Color and Shape:SolidMolecular weight:431.29Ref: TM-T4598
1mg40.00€2mg52.00€5mg79.00€1mL*10mM (DMSO)87.00€10mg116.00€25mg188.00€50mg281.00€100mg420.00€LIMKi 3
CAS:Controlled ProductApplications LIMKi 3 is a LIM kinase 1 (LIMK1) inhibitor that has antitumor properties.
References Charkrabarti, R.; et al.: PCT Int. Appl. 46pp. Patent 2013 CODEN:PIXXD2Formula:C17H14Cl2F2N4OSColor and Shape:NeatMolecular weight:431.287LIMKi 3
CAS:LIMKi 3 is a sesquiterpene lactone that has been shown to activate the LIM kinase pathway. This pathway is involved in axonal growth, neuronal differentiation, and apoptosis. It has been shown to induce apoptosis in HL-60 cells and malignant brain cells. LIMKi 3 also inhibits HIV infection by interrupting the production of effector proteins such as tat and rev, which are necessary for viral replication. The compound has potent antitumor activity against human tumor cell lines in vitro and in vivo with no observed toxicity to normal tissues.Formula:C17H14Cl2F2N4OSPurity:Min. 95%Molecular weight:431.29 g/mol







