
CAS 1338247-53-2
:4,5,6,7-Tetrahydro-3-(1-methylethyl)-1H-pyrazolo[3,4-c]pyridine
Description:
4,5,6,7-Tetrahydro-3-(1-methylethyl)-1H-pyrazolo[3,4-c]pyridine is a heterocyclic organic compound characterized by its bicyclic structure, which includes a pyrazole ring fused to a pyridine ring. This compound features a tetrahydro configuration, indicating the presence of four hydrogen atoms that saturate the ring system, contributing to its stability and reactivity. The presence of the isopropyl group (1-methylethyl) at the 3-position of the pyrazolo ring enhances its lipophilicity, potentially influencing its biological activity and solubility in organic solvents. The compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. As with many heterocycles, the electronic properties and steric factors associated with the substituents can significantly affect its reactivity and interactions in various chemical environments. Further studies would be necessary to elucidate its specific properties and potential uses in research or industry.
Formula:C9H15N3
InChI:InChI=1S/C9H15N3/c1-6(2)9-7-3-4-10-5-8(7)11-12-9/h6,10H,3-5H2,1-2H3,(H,11,12)
InChI key:InChIKey=WHZFRXMNXMNTSG-UHFFFAOYSA-N
SMILES:C(C)(C)C=1C2=C(NN1)CNCC2
Synonyms:- 4,5,6,7-Tetrahydro-3-(1-methylethyl)-1H-pyrazolo[3,4-c]pyridine
- 1H-Pyrazolo[3,4-c]pyridine, 4,5,6,7-tetrahydro-3-(1-methylethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.