CAS 133825-81-7
:Urea, N-[2,6-bis(1-methylethyl)phenyl]-N′-[[1-[4-(dimethylamino)phenyl]cyclopentyl]methyl]-, hydrochloride (1:1)
Description:
The chemical substance known as Urea, N-[2,6-bis(1-methylethyl)phenyl]-N′-[[1-[4-(dimethylamino)phenyl]cyclopentyl]methyl]-, hydrochloride (1:1), with CAS number 133825-81-7, is a synthetic compound primarily utilized in pharmaceutical applications. It features a complex molecular structure characterized by a urea functional group, which is central to its reactivity and biological activity. The presence of bulky substituents, such as the 2,6-bis(1-methylethyl)phenyl group and the dimethylamino-phenyl-cyclopentyl moiety, contributes to its unique properties, including potential lipophilicity and steric hindrance. As a hydrochloride salt, it is typically more soluble in water, enhancing its bioavailability. This compound may exhibit various pharmacological effects, making it of interest in drug development. However, specific characteristics such as melting point, solubility, and stability would depend on experimental conditions and require empirical data for precise determination. Safety and handling precautions should be observed due to its chemical nature and potential biological activity.
Formula:C27H39N3O·ClH
InChI:InChI=1S/C27H39N3O.ClH/c1-19(2)23-10-9-11-24(20(3)4)25(23)29-26(31)28-18-27(16-7-8-17-27)21-12-14-22(15-13-21)30(5)6;/h9-15,19-20H,7-8,16-18H2,1-6H3,(H2,28,29,31);1H
InChI key:InChIKey=SDOOGTHIDFZUNM-UHFFFAOYSA-N
SMILES:C(NC(NC1=C(C(C)C)C=CC=C1C(C)C)=O)C2(CCCC2)C3=CC=C(N(C)C)C=C3.Cl
Synonyms:- N-[2,6-Bis(1-methylethyl)phenyl]-N′-[[1-[4-(dimethylamino)phenyl]cyclopentyl]methyl]urea hydrochloride
- ATR 101
- Urea, N-[2,6-bis(1-methylethyl)phenyl]-N′-[[1-[4-(dimethylamino)phenyl]cyclopentyl]methyl]-, hydrochloride (1:1)
- Urea, N-[2,6-bis(1-methylethyl)phenyl]-N′-[[1-[4-(dimethylamino)phenyl]cyclopentyl]methyl]-, monohydrochloride
- PD 132301-2
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Nevanimibe hydrochloride
CAS:Nevanimibe hydrochloride (PD-132301 hydrochloride) is an orally active and selective inhibitor of acyl-coenzyme A:cholesterol O-acyltransferase 1 (ACAT1) (EC50Formula:C27H40ClN3OPurity:99.75%Color and Shape:SolidMolecular weight:458.08Ref: TM-T12225L
1mg95.00€5mg202.00€10mg283.00€25mg439.00€50mg562.00€100mg747.00€1mL*10mM (DMSO)224.00€Nevanimibe Hydrochloride
CAS:Controlled ProductFormula:C27H39N3O·ClHColor and Shape:NeatMolecular weight:458.079Nevanimibe hydrochloride
CAS:Nevanimibe is a non-steroidal androgen that has been shown to reduce the size of the adrenal glands. It inhibits 17-hydroxylase activity and prevents the synthesis of 17-hydroxyprogesterone, which is a mineralocorticoid. Nevanimibe also inhibits cellular hypertrophy, an endpoint in clinical laboratory tests. In vitro studies have shown nevanimibe to be effective against adrenocortical carcinoma cells and to inhibit their growth. The drug has been found to be active against some strains of Staphylococcus aureus, but not against Mycobacterium tuberculosis or other acid-fast bacteria.
Formula:C27H40ClN3OPurity:Min. 95%Molecular weight:458.1 g/mol



