CAS 13383-63-6

1-(2,4,6-Trihydroxy-3,5-dimethylphenyl)ethanone

Description:

1-(2,4,6-Trihydroxy-3,5-dimethylphenyl)ethanone, also known by its CAS number 13383-63-6, is an organic compound characterized by its phenolic structure, which includes multiple hydroxyl groups that contribute to its reactivity and solubility in polar solvents. This compound features a ketone functional group, which is indicative of its potential as a reactive intermediate in various chemical reactions. The presence of three hydroxyl groups on the aromatic ring enhances its antioxidant properties, making it of interest in biochemical applications. Additionally, the methyl groups on the aromatic ring can influence its steric hindrance and electronic properties, affecting its interactions with other molecules. This compound may exhibit biological activity, including antimicrobial or anti-inflammatory effects, due to its structural characteristics. Its solubility, stability, and reactivity can vary depending on the pH and the presence of other chemical species in the environment. Overall, 1-(2,4,6-Trihydroxy-3,5-dimethylphenyl)ethanone is a versatile compound with potential applications in pharmaceuticals and materials science.

Formula: C₁₀H₁₂O₄

InChI: InChI=1S/C10H12O4/c1-4-8(12)5(2)10(14)7(6(3)11)9(4)13/h12-14H,1-3H3

InChI key: InChIKey=GIMGGNBXMNVHHR-UHFFFAOYSA-N

SMILES: C(C)(=O)C1=C(O)C(C)=C(O)C(C)=C1O

Synonyms:

• Acetophenone, 2′,4′,6′-trihydroxy-3′,5′-dimethyl-
• Ethanone, 1-(2,4,6-trihydroxy-3,5-dimethylphenyl)-
• 1-(2,4,6-Trihydroxy-3,5-dimethylphenyl)ethanone
• Phloroacetophenone, 3′,5′-dimethyl-