CAS 133830-31-6

[4-(4-fluorobenzoyl)phenyl] acetate

Description:

[4-(4-Fluorobenzoyl)phenyl] acetate, with the CAS number 133830-31-6, is an organic compound characterized by its aromatic structure, which includes a fluorobenzoyl group and an acetate moiety. This compound typically exhibits a white to off-white crystalline appearance and is soluble in organic solvents such as acetone and ethanol, but may have limited solubility in water due to its hydrophobic aromatic components. The presence of the fluorine atom in the benzoyl group can influence its chemical reactivity and physical properties, such as boiling and melting points, as well as its electronic characteristics, potentially enhancing its lipophilicity. This compound may be of interest in various fields, including pharmaceuticals and materials science, due to its potential applications in drug development or as an intermediate in organic synthesis. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₁₅H₁₁FO₃

InChI: InChI=1/C15H11FO3/c1-10(17)19-14-8-4-12(5-9-14)15(18)11-2-6-13(16)7-3-11/h2-9H,1H3

SMILES: CC(=O)Oc1ccc(cc1)C(=O)c1ccc(cc1)F

4-Acetoxy-4′-fluorobenzophenone

CAS: 133830-31-6

Formula: C₁₅H₁₁FO₃

Purity: 90.0%

Molecular weight: 258.248

Ref: 10-F201844