CAS 133840-96-7

2-Chloro-6-(trifluoromethoxy)-benzothiazole

Description:

2-Chloro-6-(trifluoromethoxy)-benzothiazole is a chemical compound characterized by its unique structure, which includes a benzothiazole ring substituted with a chlorine atom and a trifluoromethoxy group. The presence of the chlorine atom enhances its reactivity, while the trifluoromethoxy group contributes to its lipophilicity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. It is often used in the synthesis of pharmaceuticals and agrochemicals due to its ability to act as a building block in various chemical reactions. The trifluoromethoxy group is particularly notable for imparting unique electronic properties, which can influence the compound's interaction with biological targets. Additionally, the compound may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, aiding in its identification and characterization. Safety data should be consulted, as halogenated compounds can pose environmental and health risks.

Formula: C₈H₃ClF₃NOS

InChI: InChI=1/C8H3ClF3NOS/c9-7-13-5-2-1-4(3-6(5)15-7)14-8(10,11)12/h1-3H

SMILES: c1cc2c(cc1OC(F)(F)F)sc(Cl)n2

Synonyms:

• 2-Chloro-6-(trifluoromethoxy)-1,3-benzothiazole
• Benzothiazole, 2-Chloro-6-(Trifluoromethoxy)-

2-Chloro-6-(trifluoromethoxy)benzothiazole

CAS: 133840-96-7

Formula: C₈H₃ClF₃NOS

Purity: 97%

Color and Shape: Solid

Molecular weight: 253.6287

Ref: IN-DA007MUV

2-Chloro-6-(trifluoromethoxy)-benzothiazole

CAS: 133840-96-7

2-Chloro-6-(trifluoromethoxy)-benzothiazole

Purity: 97%

Molecular weight: 253.63g/mol

Ref: 54-PC520861

2-Chloro-6-(trifluoromethoxy)benzo[d]thiazole

CAS: 133840-96-7

Formula: C₈H₃ClF₃NOS

Purity: 97%

Color and Shape: Solid

Molecular weight: 253.62

Ref: 10-F093297

2-Chloro-6-(trifluoromethoxy)benzo[d]thiazole

Controlled Product

CAS: 133840-96-7

Formula: C₈H₃NOF₃SCl

Color and Shape: Neat

Molecular weight: 253.62

Ref: TR-C597533