CAS 133842-36-1
:1-Bromo-4-(butoxymethyl)benzene
Description:
1-Bromo-4-(butoxymethyl)benzene, with the CAS number 133842-36-1, is an organic compound characterized by the presence of a bromine atom and a butoxymethyl group attached to a benzene ring. This compound features a bromine substituent at the para position relative to the butoxymethyl group, which influences its reactivity and physical properties. Typically, such compounds exhibit moderate solubility in organic solvents due to the hydrophobic nature of the aromatic ring and the butoxy group, while being less soluble in water. The presence of the bromine atom makes it a potential electrophile, allowing it to participate in various chemical reactions, such as nucleophilic substitutions. Additionally, the butoxymethyl group can enhance the compound's lipophilicity, making it useful in applications such as organic synthesis and as an intermediate in the production of other chemical entities. Safety considerations should be taken into account, as brominated compounds can pose environmental and health risks. Proper handling and disposal methods are essential when working with this substance.
Formula:C11H15BrO
InChI:InChI=1S/C11H15BrO/c1-2-3-8-13-9-10-4-6-11(12)7-5-10/h4-7H,2-3,8-9H2,1H3
InChI key:InChIKey=BVYYBXJRMKFITN-UHFFFAOYSA-N
SMILES:C(OCCCC)C1=CC=C(Br)C=C1
Synonyms:- 4-Bromobenzyl butyl ether
- 1-Bromo-4-(butoxymethyl)benzene
- p-Bromobenzyl butyl ether
- Benzene, 1-bromo-4-(butoxymethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.