CymitQuimica logo

CAS 133843-02-4

:

4,7,10,13,16,19-Hexaoxadocosa-1,21-diene

Description:
4,7,10,13,16,19-Hexaoxadocosa-1,21-diene is a synthetic organic compound characterized by its unique structure, which includes a long carbon chain interspersed with multiple ether linkages. This compound features six ether groups (–O–) within a 21-carbon backbone, contributing to its hydrophilicity and potential solubility in polar solvents. The presence of diene functionality indicates that it contains two double bonds, which can participate in various chemical reactions, including polymerization and cross-linking. Its molecular structure suggests potential applications in materials science, particularly in the development of polymers or surfactants. The compound's properties, such as melting point, boiling point, and reactivity, would be influenced by the arrangement of its functional groups and the overall molecular geometry. Additionally, due to its complex structure, it may exhibit interesting physical properties, such as flexibility and thermal stability, making it a candidate for specialized applications in fields like nanotechnology or drug delivery systems. However, specific experimental data would be necessary to fully characterize its behavior and potential uses.
Formula:C16H30O6
InChI:InChI=1S/C16H30O6/c1-3-5-17-7-9-19-11-13-21-15-16-22-14-12-20-10-8-18-6-4-2/h3-4H,1-2,5-16H2
InChI key:InChIKey=ZXXOEQSHMBBEDA-UHFFFAOYSA-N
SMILES:C(COCCOCCOCC=C)OCCOCCOCC=C
Synonyms:
  • 4,7,10,13,16,19-Hexaoxadocosa-1,21-diene
  • Pentaethylene glycol diallyl ether
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.