CAS 1338494-56-6
:1-(1-Methylethyl)-2-pyrrolidinecarboxamide
Description:
1-(1-Methylethyl)-2-pyrrolidinecarboxamide, also known by its CAS number 1338494-56-6, is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered nitrogen-containing heterocycle. This compound features a carboxamide functional group, contributing to its potential as a polar molecule with hydrogen-bonding capabilities. The presence of the isopropyl group (1-methylethyl) enhances its hydrophobic characteristics, influencing its solubility and interaction with biological systems. Typically, compounds of this nature may exhibit properties such as moderate to high melting points and varying solubility in organic solvents, depending on the specific substituents and their arrangement. Additionally, the structural features suggest potential applications in pharmaceuticals or agrochemicals, where the pyrrolidine framework is often associated with bioactive properties. As with many nitrogen-containing compounds, it may also participate in various chemical reactions, including acylation and amide bond formation, making it a versatile building block in synthetic chemistry.
Formula:C8H16N2O
InChI:InChI=1S/C8H16N2O/c1-6(2)10-5-3-4-7(10)8(9)11/h6-7H,3-5H2,1-2H3,(H2,9,11)
InChI key:InChIKey=HRJKYJQVBJYEBH-UHFFFAOYSA-N
SMILES:C(N)(=O)C1N(C(C)C)CCC1
Synonyms:- 1-(1-Methylethyl)-2-pyrrolidinecarboxamide
- 2-Pyrrolidinecarboxamide, 1-(1-methylethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.