CymitQuimica logo

CAS 1338494-66-8

:

2-(Azidomethyl)[1,2,4]triazolo[1,5-a]pyrimidine

Description:
2-(Azidomethyl)[1,2,4]triazolo[1,5-a]pyrimidine is a chemical compound characterized by its unique structure, which includes a triazole ring fused to a pyrimidine moiety. The presence of the azidomethyl group introduces notable reactivity, particularly in click chemistry applications, making it a valuable intermediate in organic synthesis. This compound typically exhibits properties associated with azides, such as being sensitive to heat and shock, and may undergo decomposition under certain conditions. Its molecular structure contributes to potential biological activity, which can be explored in medicinal chemistry. The compound is likely to be soluble in polar organic solvents, and its stability can vary depending on environmental conditions. Safety precautions are essential when handling this substance due to the inherent risks associated with azides. Overall, 2-(Azidomethyl)[1,2,4]triazolo[1,5-a]pyrimidine represents a versatile building block in the synthesis of more complex molecules, particularly in the fields of pharmaceuticals and materials science.
Formula:C6H5N7
InChI:InChI=1S/C6H5N7/c7-12-9-4-5-10-6-8-2-1-3-13(6)11-5/h1-3H,4H2
InChI key:InChIKey=MKIZBVKFASNVFC-UHFFFAOYSA-N
SMILES:C(N=[N+]=[N-])C=1N=C2N(N1)C=CC=N2
Synonyms:
  • 2-(Azidomethyl)[1,2,4]triazolo[1,5-a]pyrimidine
  • [1,2,4]Triazolo[1,5-a]pyrimidine, 2-(azidomethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.