CAS 1338494-69-1

4-(Dimethoxymethyl)-5-methyl-2-pyrimidinamine

Description:

4-(Dimethoxymethyl)-5-methyl-2-pyrimidinamine is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic heterocycle containing two nitrogen atoms at positions 2 and 4. This compound features a dimethoxymethyl group, indicating the presence of two methoxy (-OCH3) groups attached to a methylene (-CH2-) bridge, contributing to its solubility and reactivity. The methyl group at position 5 of the pyrimidine ring enhances its hydrophobic character. This compound may exhibit biological activity, potentially serving as a precursor or intermediate in pharmaceutical synthesis. Its molecular structure suggests it could participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. The presence of functional groups such as amines and methoxy groups may influence its interaction with biological targets, making it of interest in medicinal chemistry. As with many organic compounds, its stability, reactivity, and potential applications would depend on specific environmental conditions and the presence of other reactants.

Formula: C₈H₁₃N₃O₂

InChI: InChI=1S/C8H13N3O2/c1-5-4-10-8(9)11-6(5)7(12-2)13-3/h4,7H,1-3H3,(H2,9,10,11)

InChI key: InChIKey=RALAQWRMEBNUOW-UHFFFAOYSA-N

SMILES: C(OC)(OC)C=1C(C)=CN=C(N)N1

Synonyms:

• 2-Pyrimidinamine, 4-(dimethoxymethyl)-5-methyl-
• 4-(Dimethoxymethyl)-5-methyl-2-pyrimidinamine