CAS 1338494-72-6

1-Amino-N,N-dimethylcyclopropanemethanamine

Description:

1-Amino-N,N-dimethylcyclopropanemethanamine, identified by its CAS number 1338494-72-6, is an organic compound characterized by the presence of a cyclopropane ring, an amino group, and two dimethyl groups attached to a methanamine structure. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in polar solvents. The cyclopropane ring contributes to its unique three-dimensional structure, potentially affecting its reactivity and interaction with biological systems. Due to the presence of the amino group, it may participate in various chemical reactions, including alkylation and acylation. Additionally, the dimethyl groups can influence steric hindrance and electronic properties, which may affect the compound's stability and reactivity. Overall, the characteristics of this compound make it of interest in fields such as medicinal chemistry and materials science, where its unique structure could lead to novel applications or therapeutic agents.

Formula: C₆H₁₄N₂

InChI: InChI=1S/C6H14N2/c1-8(2)5-6(7)3-4-6/h3-5,7H2,1-2H3

InChI key: InChIKey=ROVFTSSCUXGEQX-UHFFFAOYSA-N

SMILES: C(N(C)C)C1(N)CC1

Synonyms:

• 1-Amino-N,N-dimethylcyclopropanemethanamine
• Cyclopropanemethanamine, 1-amino-N,N-dimethyl-
• 1-((Dimethylamino)methyl)cyclopropan-1-amine