CAS 1338494-94-2
:2-(2-Methoxyethoxy)-4-methyl-5-thiazolecarboxylic acid
Description:
2-(2-Methoxyethoxy)-4-methyl-5-thiazolecarboxylic acid is a chemical compound characterized by its thiazole ring, which contributes to its biological activity and potential applications in pharmaceuticals. The presence of a carboxylic acid functional group indicates that it can participate in acid-base reactions and may exhibit solubility in polar solvents. The methoxyethoxy substituent enhances its solubility and may influence its interaction with biological targets. This compound is likely to have moderate to high stability under standard conditions, but its reactivity can vary depending on the presence of specific functional groups and environmental factors. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of compounds with antimicrobial or anti-inflammatory properties. Additionally, the thiazole moiety is often associated with various biological activities, making this compound of interest for further research in drug development and synthesis. As with any chemical substance, safety data and handling precautions should be considered when working with this compound.
Formula:C8H11NO4S
InChI:InChI=1S/C8H11NO4S/c1-5-6(7(10)11)14-8(9-5)13-4-3-12-2/h3-4H2,1-2H3,(H,10,11)
InChI key:InChIKey=KRYDWKOXQCAKOY-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1SC(OCCOC)=NC1C
Synonyms:- 2-(2-Methoxyethoxy)-4-methyl-1,3-thiazole-5-carboxylic acid
- 5-Thiazolecarboxylic acid, 2-(2-methoxyethoxy)-4-methyl-
- 2-(2-Methoxyethoxy)-4-methyl-5-thiazolecarboxylic acid
- 2-(2-methoxyethoxy)-4-methylthiazole-5-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.