CymitQuimica logo

CAS 1338494-98-6

:

1,3-Dihydro-1,3-dioxo-2H-isoindole-2-acetic acid 2-(2-methyl-1-oxopropyl)hydrazide

Description:
1,3-Dihydro-1,3-dioxo-2H-isoindole-2-acetic acid 2-(2-methyl-1-oxopropyl)hydrazide, identified by its CAS number 1338494-98-6, is a chemical compound that features a complex structure characterized by the presence of an isoindole core, dioxo functional groups, and a hydrazide moiety. This compound typically exhibits properties associated with both hydrazides and isoindole derivatives, which may include potential biological activity, such as antimicrobial or anticancer effects, although specific biological data may vary. The presence of the dioxo groups suggests that it may participate in various chemical reactions, including nucleophilic attacks or coordination with metal ions. Additionally, the hydrazide functional group can engage in hydrogen bonding, influencing its solubility and reactivity. The compound's molecular structure indicates that it may be of interest in medicinal chemistry and drug development, particularly for its potential therapeutic applications. However, detailed studies would be necessary to fully elucidate its properties and potential uses in various fields.
Formula:C14H15N3O4
InChI:InChI=1S/C14H15N3O4/c1-8(2)12(19)16-15-11(18)7-17-13(20)9-5-3-4-6-10(9)14(17)21/h3-6,8H,7H2,1-2H3,(H,15,18)(H,16,19)
InChI key:InChIKey=KENVIWSADGIMDU-UHFFFAOYSA-N
SMILES:O=C1C=2C(C(=O)N1CC(NNC(C(C)C)=O)=O)=CC=CC2
Synonyms:
  • 2H-Isoindole-2-acetic acid, 1,3-dihydro-1,3-dioxo-, 2-(2-methyl-1-oxopropyl)hydrazide
  • 1,3-Dihydro-1,3-dioxo-2H-isoindole-2-acetic acid 2-(2-methyl-1-oxopropyl)hydrazide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.