CAS 1338495-02-5
:1,1-Dimethylethyl 4-[(1-ethyl-1H-pyrazol-3-yl)carbonyl]-1-piperazinecarboxylate
Description:
1,1-Dimethylethyl 4-[(1-ethyl-1H-pyrazol-3-yl)carbonyl]-1-piperazinecarboxylate, identified by its CAS number 1338495-02-5, is a chemical compound characterized by its complex structure, which includes a piperazine ring and a pyrazole moiety. This compound typically exhibits properties associated with both piperazine derivatives and pyrazole-based compounds, such as potential biological activity, including antimicrobial or anti-inflammatory effects. The presence of the dimethyl group contributes to its steric hindrance, which may influence its interaction with biological targets. Additionally, the carbonyl group linked to the pyrazole ring suggests potential reactivity, making it a candidate for further chemical modifications. The compound's solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. Overall, this substance may be of interest in pharmaceutical research and development, particularly in the design of new therapeutic agents. However, specific experimental data would be necessary to fully characterize its physical and chemical properties.
Formula:C15H24N4O3
InChI:InChI=1S/C15H24N4O3/c1-5-19-7-6-12(16-19)13(20)17-8-10-18(11-9-17)14(21)22-15(2,3)4/h6-7H,5,8-11H2,1-4H3
InChI key:InChIKey=SBQCWZFAGNDHMQ-UHFFFAOYSA-N
SMILES:C(=O)(C1=NN(CC)C=C1)N2CCN(C(OC(C)(C)C)=O)CC2
Synonyms:- 1-Piperazinecarboxylic acid, 4-[(1-ethyl-1H-pyrazol-3-yl)carbonyl]-, 1,1-dimethylethyl ester
- 1,1-Dimethylethyl 4-[(1-ethyl-1H-pyrazol-3-yl)carbonyl]-1-piperazinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.