CAS 1338495-08-1
:N,6-Dimethyl-3-(trifluoromethyl)-6H-1,2,4-oxadiazin-5-amine
Description:
N,6-Dimethyl-3-(trifluoromethyl)-6H-1,2,4-oxadiazin-5-amine is a chemical compound characterized by its unique oxadiazine structure, which includes a five-membered ring containing nitrogen and oxygen atoms. This compound features a trifluoromethyl group, which is known for its strong electron-withdrawing properties, enhancing the compound's reactivity and potential biological activity. The presence of dimethyl groups contributes to its steric bulk, influencing its interactions with other molecules. Typically, compounds of this nature may exhibit properties such as antimicrobial or herbicidal activity, making them of interest in agricultural and pharmaceutical applications. The specific arrangement of substituents on the oxadiazine ring can significantly affect the compound's solubility, stability, and overall reactivity. Additionally, the CAS number 1338495-08-1 serves as a unique identifier for this substance, facilitating its identification in chemical databases and regulatory frameworks. Overall, N,6-Dimethyl-3-(trifluoromethyl)-6H-1,2,4-oxadiazin-5-amine represents a class of compounds with potential utility in various chemical and biological contexts.
Formula:C6H8F3N3O
InChI:InChI=1S/C6H8F3N3O/c1-3-4(10-2)11-5(12-13-3)6(7,8)9/h3H,1-2H3,(H,10,11,12)
InChI key:InChIKey=JEAMWJXRFXGHEU-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1N=C(NC)C(C)ON1
Synonyms:- 6H-1,2,4-Oxadiazin-5-amine, N,6-dimethyl-3-(trifluoromethyl)-
- N,6-Dimethyl-3-(trifluoromethyl)-6H-1,2,4-oxadiazin-5-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.