CAS 1338495-10-5
:N-Methyl-3-(trifluoromethyl)-6H-1,2,4-oxadiazin-5-amine
Description:
N-Methyl-3-(trifluoromethyl)-6H-1,2,4-oxadiazin-5-amine is a chemical compound characterized by its unique oxadiazine structure, which includes a trifluoromethyl group that enhances its reactivity and potential applications in various fields. This compound features a nitrogen-containing heterocyclic ring, contributing to its stability and potential biological activity. The presence of the trifluoromethyl group is significant, as it can influence the compound's lipophilicity and overall pharmacokinetic properties, making it of interest in medicinal chemistry. Additionally, the N-methyl substitution may affect its solubility and interaction with biological targets. The compound's CAS number, 1338495-10-5, allows for precise identification and facilitates research and regulatory processes. Overall, N-Methyl-3-(trifluoromethyl)-6H-1,2,4-oxadiazin-5-amine is a compound of interest for its potential applications in pharmaceuticals, agrochemicals, and materials science, warranting further investigation into its properties and uses.
Formula:C5H6F3N3O
InChI:InChI=1S/C5H6F3N3O/c1-9-3-2-12-11-4(10-3)5(6,7)8/h2H2,1H3,(H,9,10,11)
InChI key:InChIKey=YTICOGGPTKOIJO-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1N=C(NC)CON1
Synonyms:- N-Methyl-3-(trifluoromethyl)-6H-1,2,4-oxadiazin-5-amine
- 6H-1,2,4-Oxadiazin-5-amine, N-methyl-3-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.