CymitQuimica logo

CAS 1338495-12-7

:

4-Methoxy-3-[(7-quinolinyloxy)methyl]benzaldehyde

Description:
4-Methoxy-3-[(7-quinolinyloxy)methyl]benzaldehyde is an organic compound characterized by its complex structure, which includes a methoxy group, a quinoline moiety, and an aldehyde functional group. This compound typically appears as a solid or crystalline substance and is soluble in organic solvents such as ethanol and dimethyl sulfoxide, but may have limited solubility in water due to its hydrophobic components. The presence of the aldehyde group suggests that it can participate in various chemical reactions, including oxidation and condensation reactions. The quinoline structure may impart biological activity, making this compound of interest in medicinal chemistry and drug development. Additionally, the methoxy group can influence the compound's electronic properties and reactivity. Overall, 4-Methoxy-3-[(7-quinolinyloxy)methyl]benzaldehyde is a versatile compound with potential applications in research and pharmaceuticals, particularly in the development of novel therapeutic agents.
Formula:C18H15NO3
InChI:InChI=1S/C18H15NO3/c1-21-18-7-4-13(11-20)9-15(18)12-22-16-6-5-14-3-2-8-19-17(14)10-16/h2-11H,12H2,1H3
InChI key:InChIKey=AGQNJEZRXXDVCP-UHFFFAOYSA-N
SMILES:O(CC1=C(OC)C=CC(C=O)=C1)C2=CC3=C(C=C2)C=CC=N3
Synonyms:
  • 4-Methoxy-3-[(7-quinolinyloxy)methyl]benzaldehyde
  • Benzaldehyde, 4-methoxy-3-[(7-quinolinyloxy)methyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.