CAS 1338495-13-8

Tetrahydro-5,5-dimethyl-2,4-dioxo-1(2H)-pyrimidinepropanoic acid

Description:

Tetrahydro-5,5-dimethyl-2,4-dioxo-1(2H)-pyrimidinepropanoic acid is a chemical compound characterized by its unique pyrimidine ring structure, which is a six-membered heterocyclic ring containing two nitrogen atoms. This compound features a tetrahydro configuration, indicating that it has undergone hydrogenation, resulting in a saturated ring system. The presence of two carbonyl groups (dioxo) contributes to its reactivity and potential applications in organic synthesis. The dimethyl groups attached to the pyrimidine ring enhance its steric properties and may influence its biological activity. As a propanoic acid derivative, it contains a carboxylic acid functional group, which can participate in various chemical reactions, including esterification and amidation. The compound's specific properties, such as solubility, melting point, and stability, would depend on its molecular interactions and the surrounding environment. Its CAS number, 1338495-13-8, allows for precise identification in chemical databases, facilitating research and application in fields such as pharmaceuticals and agrochemicals.

Formula: C₉H₁₄N₂O₄

InChI: InChI=1S/C9H14N2O4/c1-9(2)5-11(4-3-6(12)13)8(15)10-7(9)14/h3-5H2,1-2H3,(H,12,13)(H,10,14,15)

InChI key: InChIKey=RFRVHFCFILXVQF-UHFFFAOYSA-N

SMILES: C(CC(O)=O)N1CC(C)(C)C(=O)NC1=O

Synonyms:

• Tetrahydro-5,5-dimethyl-2,4-dioxo-1(2H)-pyrimidinepropanoic acid
• 1(2H)-Pyrimidinepropanoic acid, tetrahydro-5,5-dimethyl-2,4-dioxo-