CAS 1338495-17-2
:1-Methyl-α-(trichloromethyl)-1H-pyrazole-4-methanol
Description:
1-Methyl-α-(trichloromethyl)-1H-pyrazole-4-methanol is a chemical compound characterized by its pyrazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. The presence of a trichloromethyl group (-CCl3) at the alpha position contributes to its reactivity and potential applications in various chemical reactions. The methanol group (-CH2OH) at the 4-position enhances its solubility in polar solvents and may influence its biological activity. This compound is typically used in research and development, particularly in the fields of agrochemicals and pharmaceuticals, due to its potential as a building block for more complex molecules. Its unique structure may impart specific properties such as antimicrobial or herbicidal activity, although detailed biological evaluations would be necessary to confirm these effects. Safety and handling precautions should be observed, as the trichloromethyl group can be associated with toxicity and environmental concerns. Overall, 1-Methyl-α-(trichloromethyl)-1H-pyrazole-4-methanol represents a versatile compound with significant implications in chemical synthesis and application.
Formula:C6H7Cl3N2O
InChI:InChI=1S/C6H7Cl3N2O/c1-11-3-4(2-10-11)5(12)6(7,8)9/h2-3,5,12H,1H3
InChI key:InChIKey=ZAFWLEBYKKUUBH-UHFFFAOYSA-N
SMILES:C(C(Cl)(Cl)Cl)(O)C1=CN(C)N=C1
Synonyms:- 1H-Pyrazole-4-methanol, 1-methyl-α-(trichloromethyl)-
- 1-Methyl-α-(trichloromethyl)-1H-pyrazole-4-methanol
- 2,2,2-Trichloro-1-(1-methyl-1H-pyrazol-4-yl)ethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.