CAS 1338495-21-8
:1,3-Dicyclohexylhexahydro-2,4,6-trioxo-5-pyrimidinecarboximidamide
Description:
1,3-Dicyclohexylhexahydro-2,4,6-trioxo-5-pyrimidinecarboximidamide is a chemical compound characterized by its complex structure, which includes a pyrimidine ring and multiple functional groups. The presence of two cyclohexyl groups contributes to its hydrophobic characteristics, while the hexahydro structure indicates saturation, suggesting stability against oxidation. The trioxo groups imply the presence of three carbonyl functionalities, which can enhance reactivity and potential interactions with other molecules. This compound may exhibit properties typical of amides, such as hydrogen bonding capabilities, which can influence its solubility and reactivity in various solvents. Its unique structure may also suggest potential applications in pharmaceuticals or materials science, although specific uses would depend on further research into its biological activity and chemical behavior. Overall, the compound's intricate arrangement of atoms and functional groups makes it a subject of interest for further study in organic chemistry and related fields.
Formula:C17H26N4O3
InChI:InChI=1S/C17H26N4O3/c18-14(19)13-15(22)20(11-7-3-1-4-8-11)17(24)21(16(13)23)12-9-5-2-6-10-12/h11-13H,1-10H2,(H3,18,19)
InChI key:InChIKey=DNRKBZZEJYJQKX-UHFFFAOYSA-N
SMILES:O=C1N(C(=O)C(C(=N)N)C(=O)N1C2CCCCC2)C3CCCCC3
Synonyms:- 1,3-Dicyclohexylhexahydro-2,4,6-trioxo-5-pyrimidinecarboximidamide
- 5-Pyrimidinecarboximidamide, 1,3-dicyclohexylhexahydro-2,4,6-trioxo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.