CAS 1338495-23-0
:2-Chloro-N-cyclopentyl-5-fluoro-4-pyrimidinamine
Description:
2-Chloro-N-cyclopentyl-5-fluoro-4-pyrimidinamine is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered heterocyclic aromatic ring containing two nitrogen atoms at positions 1 and 3. The presence of a chlorine atom at the 2-position and a fluorine atom at the 5-position contributes to its reactivity and potential biological activity. The cyclopentyl group attached to the nitrogen atom enhances its lipophilicity, which may influence its pharmacokinetic properties. This compound may exhibit properties typical of pyrimidine derivatives, such as potential use in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. Its specific interactions and applications would depend on further studies, including its mechanism of action, efficacy, and safety profile. As with many halogenated compounds, it may also exhibit unique characteristics in terms of stability and reactivity, making it of interest in both synthetic and medicinal chemistry contexts.
Formula:C9H11ClFN3
InChI:InChI=1S/C9H11ClFN3/c10-9-12-5-7(11)8(14-9)13-6-3-1-2-4-6/h5-6H,1-4H2,(H,12,13,14)
InChI key:InChIKey=HZWNTIIEAVMVKW-UHFFFAOYSA-N
SMILES:N(C=1C(F)=CN=C(Cl)N1)C2CCCC2
Synonyms:- 4-Pyrimidinamine, 2-chloro-N-cyclopentyl-5-fluoro-
- 2-Chloro-N-cyclopentyl-5-fluoro-4-pyrimidinamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.