CymitQuimica logo

CAS 1338495-24-1

:

4-(1,3-Benzodioxol-5-ylmethyl)tetrahydro-2H-pyran-4-carboxylic acid

Description:
4-(1,3-Benzodioxol-5-ylmethyl)tetrahydro-2H-pyran-4-carboxylic acid is a chemical compound characterized by its complex structure, which includes a tetrahydropyran ring and a benzodioxole moiety. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of the benzodioxole group suggests potential applications in medicinal chemistry, as this structural motif is often associated with various biological activities. The tetrahydropyran ring enhances the compound's stability and may influence its solubility and reactivity. Additionally, the specific arrangement of functional groups can affect the compound's interactions with biological targets, making it of interest for further research in pharmacology and organic synthesis. Its CAS number, 1338495-24-1, allows for precise identification in chemical databases, facilitating studies related to its synthesis, properties, and potential applications in drug development or other fields of chemistry. Overall, this compound exemplifies the intricate relationship between molecular structure and chemical behavior.
Formula:C14H16O5
InChI:InChI=1S/C14H16O5/c15-13(16)14(3-5-17-6-4-14)8-10-1-2-11-12(7-10)19-9-18-11/h1-2,7H,3-6,8-9H2,(H,15,16)
InChI key:InChIKey=KVIJZRLNLUIFIZ-UHFFFAOYSA-N
SMILES:C(C1(C(O)=O)CCOCC1)C=2C=C3C(=CC2)OCO3
Synonyms:
  • 2H-Pyran-4-carboxylic acid, 4-(1,3-benzodioxol-5-ylmethyl)tetrahydro-
  • 4-(1,3-Benzodioxol-5-ylmethyl)tetrahydro-2H-pyran-4-carboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.