CAS 1338495-32-1

1,3-Dimethyl-α-(trichloromethyl)-1H-pyrazole-4-methanol

Description:

1,3-Dimethyl-α-(trichloromethyl)-1H-pyrazole-4-methanol is a chemical compound characterized by its unique pyrazole structure, which includes a trichloromethyl group and a hydroxymethyl substituent. This compound features a pyrazole ring, a five-membered aromatic heterocycle containing two nitrogen atoms, which contributes to its reactivity and potential biological activity. The presence of the trichloromethyl group enhances its lipophilicity and may influence its interaction with biological targets. The dimethyl groups on the pyrazole ring can affect the compound's steric properties and solubility. Additionally, the hydroxymethyl group can participate in hydrogen bonding, potentially impacting its solubility in polar solvents and its reactivity in various chemical reactions. Overall, this compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry and agrochemical applications. However, specific safety and handling guidelines should be followed due to the presence of chlorine atoms, which can pose environmental and health risks.

Formula: C₇H₉Cl₃N₂O

InChI: InChI=1S/C7H9Cl3N2O/c1-4-5(3-12(2)11-4)6(13)7(8,9)10/h3,6,13H,1-2H3

InChI key: InChIKey=VITZQIRSDLPQDD-UHFFFAOYSA-N

SMILES: C(C(Cl)(Cl)Cl)(O)C1=CN(C)N=C1C

Synonyms:

• 1H-Pyrazole-4-methanol, 1,3-dimethyl-α-(trichloromethyl)-
• 1,3-Dimethyl-α-(trichloromethyl)-1H-pyrazole-4-methanol