CymitQuimica logo

CAS 1338495-33-2

:

1,5-Dimethyl-α-(trichloromethyl)-1H-pyrazole-4-methanol

Description:
1,5-Dimethyl-α-(trichloromethyl)-1H-pyrazole-4-methanol is a chemical compound characterized by its pyrazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance features a trichloromethyl group, which significantly influences its reactivity and potential applications, particularly in agrochemicals and pharmaceuticals. The presence of two methyl groups at the 1 and 5 positions of the pyrazole ring contributes to its lipophilicity, potentially affecting its solubility and biological activity. The hydroxymethyl group at the 4 position introduces a functional group that can participate in various chemical reactions, enhancing its versatility. This compound may exhibit specific biological activities, making it of interest in research and development. However, its trichloromethyl moiety raises concerns regarding environmental persistence and toxicity, necessitating careful handling and assessment in any practical applications. Overall, 1,5-Dimethyl-α-(trichloromethyl)-1H-pyrazole-4-methanol is a complex molecule with unique properties that warrant further investigation for its potential uses.
Formula:C7H9Cl3N2O
InChI:InChI=1S/C7H9Cl3N2O/c1-4-5(3-11-12(4)2)6(13)7(8,9)10/h3,6,13H,1-2H3
InChI key:InChIKey=OKWUIVWVNIYPQV-UHFFFAOYSA-N
SMILES:C(C(Cl)(Cl)Cl)(O)C1=C(C)N(C)N=C1
Synonyms:
  • 1,5-Dimethyl-α-(trichloromethyl)-1H-pyrazole-4-methanol
  • 1H-Pyrazole-4-methanol, 1,5-dimethyl-α-(trichloromethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.