CymitQuimica logo

CAS 1338563-18-0

:

Ethyl 2,3,4,5-tetrahydro-1H-pyrrolo[1,2-a][1,4]diazepine-8-carboxylate

Description:
Ethyl 2,3,4,5-tetrahydro-1H-pyrrolo[1,2-a][1,4]diazepine-8-carboxylate is a chemical compound characterized by its complex bicyclic structure, which includes a pyrrole and diazepine moiety. This compound features a carboxylate functional group, contributing to its potential reactivity and solubility properties. The presence of the ethyl ester group enhances its lipophilicity, which may influence its biological activity and pharmacokinetics. Typically, compounds of this nature may exhibit a range of biological activities, making them of interest in medicinal chemistry and drug development. The tetrahydro configuration suggests that the compound is saturated, which can affect its stability and interaction with biological targets. Additionally, the specific stereochemistry of the compound can play a crucial role in its pharmacological effects. Overall, this compound's unique structural features may provide avenues for research in various fields, including pharmaceuticals and organic synthesis. However, detailed studies would be necessary to fully elucidate its properties and potential applications.
Formula:C11H16N2O2
InChI:InChI=1S/C11H16N2O2/c1-2-15-11(14)9-6-10-7-12-4-3-5-13(10)8-9/h6,8,12H,2-5,7H2,1H3
InChI key:InChIKey=LSFWTZYBADLVSP-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C=1C=C2N(C1)CCCNC2
Synonyms:
  • 1H-Pyrrolo[1,2-a][1,4]diazepine-8-carboxylic acid, 2,3,4,5-tetrahydro-, ethyl ester
  • Ethyl 2,3,4,5-tetrahydro-1H-pyrrolo[1,2-a][1,4]diazepine-8-carboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.