
CAS 1338588-80-9
:A′-Neo-26,28-dinorgammacer-9(11)-ene-3,7,19-triol, 17-(hydroxymethyl)-13-methyl-, 7-acetate, (3β,7β,19α,21β)-
Description:
A′-Neo-26,28-dinorgammacer-9(11)-ene-3,7,19-triol, 17-(hydroxymethyl)-13-methyl-, 7-acetate, (3β,7β,19α,21β)- is a complex organic compound characterized by its unique steroidal structure. It features multiple hydroxyl groups, which contribute to its solubility and reactivity, and an acetate group that can influence its biological activity and stability. The presence of specific stereochemistry, indicated by the (3β,7β,19α,21β) configuration, suggests that it may interact with biological systems in a specific manner, potentially affecting its pharmacological properties. The compound's molecular framework includes a triterpenoid backbone, which is common in various natural products and can exhibit a range of biological activities, including anti-inflammatory and immunomodulatory effects. Its CAS number, 1338588-80-9, allows for precise identification in chemical databases, facilitating research and application in fields such as medicinal chemistry and pharmacology. Overall, this compound represents a significant interest in the study of steroid derivatives and their potential therapeutic uses.
Formula:C32H52O5
InChI:InChI=1S/C32H52O5/c1-18(2)21-15-22(35)27-31(8)12-9-20-26(30(31,7)13-14-32(21,27)17-33)23(37-19(3)34)16-24-28(4,5)25(36)10-11-29(20,24)6/h9,18,21-27,33,35-36H,10-17H2,1-8H3/t21-,22+,23-,24-,25-,26-,27+,29+,30-,31+,32+/m0/s1
InChI key:InChIKey=XLTANSFXBPNHCI-WVPSKIRCSA-N
SMILES:C(O)[C@]12[C@@]([C@]3(C)[C@@](C)(CC1)[C@]4(C(=CC3)[C@]5(C)[C@@](C[C@@H]4OC(C)=O)(C(C)(C)[C@@H](O)CC5)[H])[H])([C@H](O)C[C@H]2C(C)C)[H]
Synonyms:- A′-Neo-26,28-dinorgammacer-9(11)-ene-3,7,19-triol, 17-(hydroxymethyl)-13-methyl-, 7-acetate, (3β,7β,19α,21β)-
- Rubiarbonol A 7-acetate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Rubiarbonol A 7-acetate
CAS:Rubiarbonol A 7-acetate is a useful organic compound for research related to life sciences. The catalog number is T126025 and the CAS number is 1338588-80-9.Formula:C32H52O5Color and Shape:SolidMolecular weight:516.763
