CAS 133860-73-8
:2,2-DIFLUORO-1-PHENYL-BUTANE-1,3-DIONE
Description:
2,2-Difluoro-1-phenyl-butane-1,3-dione, with the CAS number 133860-73-8, is an organic compound characterized by its unique structure featuring a butane backbone with two fluorine atoms and a phenyl group. This compound typically exhibits a yellow to orange color in its solid state and is known for its potential applications in organic synthesis and as a building block in pharmaceuticals. The presence of the fluorine atoms enhances its lipophilicity and can influence its reactivity and biological activity. The diketone functional groups contribute to its ability to participate in various chemical reactions, such as condensation and Michael addition. Additionally, the compound's stability and solubility can vary depending on the solvent used, making it versatile in different chemical environments. Safety data should be consulted for handling and storage, as fluorinated compounds can pose specific health and environmental risks. Overall, 2,2-difluoro-1-phenyl-butane-1,3-dione is a noteworthy compound in the realm of synthetic organic chemistry.
Formula:C10H8F2O2
InChI:InChI=1/C10H8F2O2/c1-7(13)10(11,12)9(14)8-5-3-2-4-6-8/h2-6H,1H3
SMILES:CC(=O)C(C(=O)c1ccccc1)(F)F
Synonyms:- 1,3-Butanedione, 2,2-difluoro-1-phenyl- (9CI)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.