CymitQuimica logo

CAS 1338650-26-2

:

1,1-Dimethylethyl N-[[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]carbamate

Description:
1,1-Dimethylethyl N-[[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]carbamate, identified by its CAS number 1338650-26-2, is a chemical compound characterized by its complex structure, which includes a carbamate functional group and an oxadiazole moiety. This compound typically exhibits properties associated with both the carbamate and oxadiazole classes, such as potential biological activity and stability under various conditions. The presence of the 4-methylphenyl group suggests that it may have hydrophobic characteristics, influencing its solubility and interaction with biological systems. Additionally, the oxadiazole ring may contribute to its reactivity and potential applications in pharmaceuticals or agrochemicals. The compound's specific characteristics, including melting point, boiling point, and solubility, would depend on its molecular interactions and the environment in which it is studied. Overall, this compound's unique structure positions it as a candidate for further research in medicinal chemistry and related fields.
Formula:C15H19N3O3
InChI:InChI=1S/C15H19N3O3/c1-10-5-7-11(8-6-10)13-17-12(21-18-13)9-16-14(19)20-15(2,3)4/h5-8H,9H2,1-4H3,(H,16,19)
InChI key:InChIKey=ZBLQUNLVEXSDSQ-UHFFFAOYSA-N
SMILES:C(NC(OC(C)(C)C)=O)C1=NC(=NO1)C2=CC=C(C)C=C2
Synonyms:
  • Carbamic acid, N-[[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-, 1,1-dimethylethyl ester
  • 1,1-Dimethylethyl N-[[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]carbamate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.