CymitQuimica logo

CAS 13388-76-6

:

3-Chloro-6,8-dimethoxyisoquinoline

Description:
3-Chloro-6,8-dimethoxyisoquinoline is a chemical compound characterized by its isoquinoline structure, which consists of a fused benzene and pyridine ring. The presence of chlorine and methoxy groups at specific positions on the isoquinoline ring significantly influences its chemical properties and reactivity. The chlorine atom introduces electronegativity, which can affect the compound's polarity and potential interactions with other molecules. The methoxy groups, being electron-donating, can enhance the compound's nucleophilicity and influence its solubility in organic solvents. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its unique structure allows for potential applications in various fields, including pharmaceuticals and agrochemicals. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 3-Chloro-6,8-dimethoxyisoquinoline is a versatile compound with distinct characteristics that warrant further investigation for its potential applications.
Formula:C11H10ClNO2
InChI:InChI=1S/C11H10ClNO2/c1-14-8-3-7-4-11(12)13-6-9(7)10(5-8)15-2/h3-6H,1-2H3
InChI key:InChIKey=BIULUAPDABAFAS-UHFFFAOYSA-N
SMILES:O(C)C=1C2=C(C=C(OC)C1)C=C(Cl)N=C2
Synonyms:
  • Isoquinoline, 3-chloro-6,8-dimethoxy-
  • NSC 118815
  • 3-Chloro-6,8-dimethoxyisoquinoline
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.