CAS 13388-94-8
:spiro[4.5]decan-6-one
Description:
Spiro[4.5]decan-6-one is a bicyclic organic compound characterized by its unique spiro structure, which consists of two fused rings sharing a single carbon atom. This compound features a ketone functional group at the 6-position, contributing to its reactivity and potential applications in organic synthesis. The molecular formula typically reflects a moderate level of complexity, indicating a balance between saturated and unsaturated carbon atoms. Its spiro configuration imparts distinctive stereochemical properties, influencing its physical characteristics such as boiling and melting points, which are generally higher than those of acyclic compounds due to increased molecular interactions. Additionally, spiro[4.5]decan-6-one may exhibit interesting chemical behavior, including potential for nucleophilic attack at the carbonyl carbon, making it a valuable intermediate in the synthesis of various organic compounds. Its unique structure and properties make it of interest in fields such as medicinal chemistry and materials science, where it can serve as a building block for more complex molecules.
Formula:C10H16O
InChI:InChI=1/C10H16O/c11-9-5-1-2-6-10(9)7-3-4-8-10/h1-8H2
SMILES:C1CCC2(CCCC2)C(=O)C1
Synonyms:- 6-Oxospiro[4.5]decane
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Spiro[4.5]decan-6-one
CAS:<p>Spiro[4.5]decan-6-one is a spirocyclic compound that belongs to the class of dienones. It is postulated to be synthesized from the condensation reaction of an imidazole and a cyclic ketone. This compound was originally isolated as a product in the crystallization process of zirconium dichloride, which was used in the immobilization of enzymes for biofuel production. Spiro[4.5]decan-6-one has been shown to be catalysed by trifluoride, which may be due to its natural products activity.</p>Formula:C10H16OPurity:Min. 95%Molecular weight:152.23 g/mol

