
CAS 133882-75-4
:9-(1,3-Benzodioxol-5-yl)-4-[(4-O-β-D-glucopyranosyl-2,3-di-O-methyl-β-D-xylopyranosyl)oxy]-6,7-dimethoxynaphtho[2,3-c]furan-1(3H)-one
Description:
The chemical substance known as 9-(1,3-Benzodioxol-5-yl)-4-[(4-O-β-D-glucopyranosyl-2,3-di-O-methyl-β-D-xylopyranosyl)oxy]-6,7-dimethoxynaphtho[2,3-c]furan-1(3H)-one, with the CAS number 133882-75-4, is a complex organic compound characterized by its intricate molecular structure, which includes multiple functional groups and sugar moieties. This compound features a naphthoquinone core, which is known for its biological activity, and is substituted with a benzodioxole and glycosylated units, contributing to its potential pharmacological properties. The presence of methoxy groups enhances its lipophilicity, potentially influencing its solubility and bioavailability. Its glycosylated structure may also play a role in its interaction with biological systems, possibly affecting its mechanism of action. Such compounds are often studied for their potential therapeutic applications, including antioxidant and anti-inflammatory effects. However, detailed studies on its specific biological activities, toxicity, and pharmacokinetics would be necessary to fully understand its potential uses in medicinal chemistry.
Formula:C34H38O16
InChI:InChI=1S/C34H38O16/c1-40-19-8-15-16(9-20(19)41-2)29(17-11-44-32(39)25(17)24(15)14-5-6-18-21(7-14)47-13-46-18)50-34-31(43-4)30(42-3)23(12-45-34)49-33-28(38)27(37)26(36)22(10-35)48-33/h5-9,22-23,26-28,30-31,33-38H,10-13H2,1-4H3/t22-,23-,26-,27+,28-,30+,31-,33+,34+/m1/s1
InChI key:InChIKey=DDUSFSKGAHCYFG-LXOHQACASA-N
SMILES:O=C1C2=C(C=3C(C(O[C@H]4[C@H](OC)[C@@H](OC)[C@H](O[C@@H]5O[C@H](CO)[C@@H](O)[C@H](O)[C@H]5O)CO4)=C2CO1)=CC(OC)=C(OC)C3)C=6C=C7C(=CC6)OCO7
Synonyms:- Naphtho[2,3-c]furan-1(3H)-one, 9-(1,3-benzodioxol-5-yl)-4-[(4-O-β-D-glucopyranosyl-2,3-di-O-methyl-β-D-xylopyranosyl)oxy]-6,7-dimethoxy-
- 9-(1,3-Benzodioxol-5-yl)-4-[(4-O-β-D-glucopyranosyl-2,3-di-O-methyl-β-D-xylopyranosyl)oxy]-6,7-dimethoxynaphtho[2,3-c]furan-1(3H)-one
- Ramontoside
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Ramontoside
CAS:Ramontoside belongs to the class of organic compounds known as lignan glycosides.Formula:C34H38O16Color and Shape:SolidMolecular weight:702.66
