CAS 133882-98-1
:creatol
Description:
Creatol, with the CAS number 133882-98-1, is a chemical compound that is primarily recognized for its role in various biochemical applications. It is often associated with the field of biochemistry and may be involved in metabolic processes. Creatol is characterized by its molecular structure, which typically includes functional groups that contribute to its reactivity and solubility in biological systems. The compound is generally stable under standard conditions but may undergo specific reactions depending on the presence of catalysts or other reagents. Its properties can include moderate polarity, which allows it to interact with both hydrophilic and hydrophobic environments. Creatol may also exhibit biological activity, making it of interest in pharmacological studies. However, detailed information regarding its specific applications, safety profile, and regulatory status may vary, and it is advisable to consult relevant scientific literature or databases for comprehensive data.
Formula:C4H7N3O2
InChI:InChI=1/C4H7N3O2/c1-7-3(9)2(8)6-4(7)5/h3,9H,1H3,(H2,5,6,8)
SMILES:CN1C(C(=NC1=N)O)O
Synonyms:- 2-Amino-5-hydroxy-1-methylimidazol-4(5H)-one
- 5-Hydroxycreatinine
- 4H-Imidazol-4-one, 2-amino-1,5-dihydro-5-hydroxy-1-methyl-
- 2-amino-5-hydroxy-1-methyl-1,5-dihydro-4H-imidazol-4-one
- Creatol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
