CAS 13389-88-3
:TETRAHYDRO-5-OXO-2-PHENYLFURAN-3-CARBOXYLIC ACID
Description:
Tetrahydro-5-oxo-2-phenylfuran-3-carboxylic acid, with the CAS number 13389-88-3, is a chemical compound characterized by its unique furan ring structure, which is a five-membered aromatic ring containing oxygen. This compound features a carboxylic acid functional group, contributing to its acidic properties and potential reactivity. The presence of a phenyl group enhances its aromatic characteristics and may influence its solubility and interaction with other molecules. Tetrahydro-5-oxo-2-phenylfuran-3-carboxylic acid is typically a solid at room temperature and may exhibit moderate stability under standard conditions. Its applications may span various fields, including pharmaceuticals and organic synthesis, where it could serve as an intermediate or a building block for more complex molecules. The compound's specific reactivity and interactions would depend on its functional groups and the surrounding environment, making it a subject of interest in chemical research and development. Safety data and handling precautions should be observed, as with any chemical substance, to ensure proper usage and minimize risks.
Formula:C11H10O4
InChI:InChI=1/C11H10O4/c12-9-6-8(11(13)14)10(15-9)7-4-2-1-3-5-7/h1-5,8,10H,6H2,(H,13,14)
SMILES:c1ccc(cc1)C1C(CC(=O)O1)C(=O)O
Synonyms:- Akos Bc-0843
- 5-Oxo-2-Phenyltetrahydrofuran-3-Carboxylic Acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.