CAS 133897-06-0
:2,4-DIMETHYL-3-PYRIDINECARBOXYLIC ACID HYDROCHLORIDE
Description:
2,4-Dimethyl-3-pyridinecarboxylic acid hydrochloride is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features two methyl groups at the 2 and 4 positions and a carboxylic acid functional group at the 3 position, contributing to its acidic properties. The hydrochloride form indicates that the compound is a salt formed with hydrochloric acid, enhancing its solubility in water and making it more stable in various environments. Typically, such compounds are utilized in pharmaceutical applications, serving as intermediates in the synthesis of biologically active molecules. The presence of the carboxylic acid group suggests potential reactivity in esterification or amidation reactions. Additionally, the methyl groups can influence the compound's lipophilicity and overall biological activity. As with many pyridine derivatives, this compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry research.
Formula:C8H10ClNO2
InChI:InChI=1/C8H9NO2.ClH/c1-5-3-4-9-6(2)7(5)8(10)11;/h3-4H,1-2H3,(H,10,11);1H
SMILES:Cc1ccnc(C)c1C(=O)O.Cl
Synonyms:- 2,4-Dimethylnicotinic Acid, Hcl
- 2,4-Dimethylpyridine-3-Carboxylic Acid Hydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
