CymitQuimica logo

CAS 1339011-02-7

:

2-Amino-N-methyl-5-(1-pyrrolidinyl)benzamide

Description:
2-Amino-N-methyl-5-(1-pyrrolidinyl)benzamide is a chemical compound characterized by its structural features, which include an amino group, a methyl group, and a pyrrolidinyl substituent attached to a benzamide framework. This compound typically exhibits properties associated with both amines and amides, such as potential solubility in polar solvents due to the presence of the amino and carbonyl functional groups. The pyrrolidinyl group contributes to its steric and electronic properties, potentially influencing its reactivity and interactions with biological targets. The compound may exhibit pharmacological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its molecular structure suggests it could participate in hydrogen bonding, which may affect its binding affinity in biological systems. As with many organic compounds, the specific characteristics such as melting point, boiling point, and spectral properties would depend on the purity and specific conditions under which the compound is analyzed. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C12H17N3O
InChI:InChI=1S/C12H17N3O/c1-14-12(16)10-8-9(4-5-11(10)13)15-6-2-3-7-15/h4-5,8H,2-3,6-7,13H2,1H3,(H,14,16)
InChI key:InChIKey=VVPOPKDWRNMWDP-UHFFFAOYSA-N
SMILES:C(NC)(=O)C=1C=C(C=CC1N)N2CCCC2
Synonyms:
  • 2-Amino-N-methyl-5-(1-pyrrolidinyl)benzamide
  • Benzamide, 2-amino-N-methyl-5-(1-pyrrolidinyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.