CAS 133902-66-6

[1-(4-Chlorophenyl)-1H-1,2,3-triazol-4-yl]methanol

Description:

[1-(4-Chlorophenyl)-1H-1,2,3-triazol-4-yl]methanol, with the CAS number 133902-66-6, is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance features a chlorophenyl group, contributing to its potential biological activity and lipophilicity. The presence of the hydroxymethyl group (-CH2OH) indicates that it can participate in hydrogen bonding, enhancing its solubility in polar solvents. The compound is of interest in medicinal chemistry due to its potential applications in pharmaceuticals, particularly as an antifungal or antibacterial agent. Its structural attributes suggest that it may interact with biological targets through various mechanisms, including enzyme inhibition or receptor binding. Additionally, the chlorophenyl moiety may influence its pharmacokinetic properties, such as absorption and distribution. Overall, [1-(4-Chlorophenyl)-1H-1,2,3-triazol-4-yl]methanol represents a versatile scaffold for further chemical modifications and investigations in drug development.

Formula: C₉H₈ClN₃O

InChI: InChI=1/C9H8ClN3O/c10-7-1-3-9(4-2-7)13-5-8(6-14)11-12-13/h1-5,14H,6H2

SMILES: c1cc(ccc1Cl)n1cc(CO)nn1

Synonyms:

• [1-(4-chlorophenyl)-1H-1,2,3-t
• 1-(4-Chlorophenyl)-1H-1,2,3-Tr
• 1-(4-Chlorophenyl)-1H-1,2,3-Triazol-4-Yl]Methano
• 1-(4-chlorophenyl)-1H-1,2,3-triazol-4-yl methanol

[1-(4-Chlorophenyl)-1H-1,2,3-triazol-4-yl]methanol

CAS: 133902-66-6

Formula: C₉H₈ClN₃O

Color and Shape: Solid

Molecular weight: 209.6323

Ref: IN-DA00807L

[1-(4-Chlorophenyl)-1H-1,2,3-triazol-4-yl]methanol

CAS: 133902-66-6

[1-(4-Chlorophenyl)-1H-1,2,3-triazol-4-yl]methanol

Purity: ≥95%

Molecular weight: 209.63g/mol

Ref: 54-OR32716

[1-(4-Chlorophenyl)-1H-1,2,3-triazol-4-yl]methanol

CAS: 133902-66-6

Versatile small molecule scaffold

Formula: C₉H₈ClN₃O

Purity: Min. 95%

Molecular weight: 209.63 g/mol

Ref: 3D-IFA90266