CAS 1339161-83-9

1-Methyl-2-(4-pyridinyl)-3-pyrrolidinamine

Description:

1-Methyl-2-(4-pyridinyl)-3-pyrrolidinamine, identified by its CAS number 1339161-83-9, is a chemical compound characterized by its unique molecular structure, which includes a pyridine ring and a pyrrolidine moiety. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in various solvents. The presence of the pyridine ring contributes to its aromatic character, potentially affecting its reactivity and interaction with biological systems. It may also exhibit pharmacological properties, making it of interest in medicinal chemistry. The compound's molecular weight, boiling point, melting point, and specific reactivity would depend on its precise structural configuration and substituents. As with many organic compounds, safety data sheets should be consulted for handling and storage guidelines, as well as potential hazards associated with exposure. Overall, 1-Methyl-2-(4-pyridinyl)-3-pyrrolidinamine represents a class of compounds that may have applications in drug development and other chemical research areas.

Formula: C₁₀H₁₅N₃

InChI: InChI=1S/C10H15N3/c1-13-7-4-9(11)10(13)8-2-5-12-6-3-8/h2-3,5-6,9-10H,4,7,11H2,1H3

InChI key: InChIKey=CDUSXKJBFXRFLU-UHFFFAOYSA-N

SMILES: NC1C(N(C)CC1)C=2C=CN=CC2

Synonyms:

• 3-Pyrrolidinamine, 1-methyl-2-(4-pyridinyl)-
• 1-Methyl-2-(4-pyridinyl)-3-pyrrolidinamine