CAS 133920-70-4
:N-(4-acetylpiperazin-1-yl)-4-fluorobenzamide
Description:
N-(4-acetylpiperazin-1-yl)-4-fluorobenzamide, with the CAS number 133920-70-4, is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features an acetyl group attached to the piperazine nitrogen, enhancing its solubility and reactivity. The presence of a fluorine atom on the benzamide moiety contributes to its lipophilicity and can influence its biological activity. The amide functional group indicates potential for hydrogen bonding, which may affect its interaction with biological targets. This compound is of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that may confer specific pharmacological properties. Its synthesis and characterization typically involve standard organic chemistry techniques, and it may be evaluated for its efficacy in various biological assays. Overall, the unique combination of functional groups in N-(4-acetylpiperazin-1-yl)-4-fluorobenzamide suggests potential applications in drug discovery and development.
Formula:C13H16FN3O2
InChI:InChI=1/C13H16FN3O2/c1-10(18)16-6-8-17(9-7-16)15-13(19)11-2-4-12(14)5-3-11/h2-5H,6-9H2,1H3,(H,15,19)
SMILES:CC(=O)N1CCN(CC1)NC(=O)c1ccc(cc1)F
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
FK 960
CAS:FK960 is a five-membered, cyclic molecule that binds to the target enzyme nicotinic acetylcholine receptor in the brain. It inhibits cholinesterase and blocks acetylcholine from binding to its receptors. This inhibition leads to an increase in acetylcholine levels in the brain and a decrease in memory loss. FK960 has been shown to be effective against neurodegenerative diseases such as Alzheimer's disease. The low molecular weight of FK960 makes it orally bioavailable and able to cross the blood-brain barrier, which is difficult for most drugs. FK960 also has an inhibitory effect on c1-6 alkyl groups found in the peripheral nervous system, which may be responsible for its effects on Alzheimer's disease.Formula:C13H16FN3O2Purity:Min. 95%Molecular weight:265.28 g/molFK960
CAS:FK962 boosts somatostatin, enhances cognition, and raises synaptic density in rat hippocampus.Formula:C13H16FN3O2Purity:98%Color and Shape:SolidMolecular weight:265.28

