CAS 133921-60-5
:4-borono-2-fluorophenylalanine
Description:
4-Borono-2-fluorophenylalanine, with the CAS number 133921-60-5, is an amino acid derivative that features a boronic acid group and a fluorine atom attached to a phenylalanine backbone. This compound is characterized by its unique functional groups, which impart specific reactivity and properties. The boron atom in the boronic acid moiety allows for potential interactions with diols and other nucleophiles, making it useful in various chemical reactions, including Suzuki coupling. The presence of the fluorine atom can enhance the compound's lipophilicity and influence its biological activity. This compound is often utilized in medicinal chemistry and biochemistry, particularly in the development of targeted therapies and as a building block in the synthesis of more complex molecules. Its structural features may also contribute to its role in studies related to protein interactions and enzyme inhibition. Overall, 4-borono-2-fluorophenylalanine is a versatile compound with significant implications in both research and pharmaceutical applications.
Formula:C9H11BFNO4
InChI:InChI=1/C9H11BFNO4/c11-7-4-6(10(15)16)2-1-5(7)3-8(12)9(13)14/h1-2,4,8,15-16H,3,12H2,(H,13,14)
SMILES:c1cc(cc(c1CC(C(=O)O)N)F)B(O)O
Synonyms:- (18F)-(10B)-L-Bpa
- 18F-10B-Fbpa
- 4-BF-Phe
- 4-Borono-2-(18F)fluoro-DL-phenylalanine
- 4-Borono-2-fluoro-L-phenylalanine
- Fluoroboronophenylalanine
- DL-Phenylalanine, 4-borono-2-(fluoro-18F)-
- 4-(dihydroxyboranyl)-2-(~18~F)fluorophenylalanine
- 4-(Dihydroxyboranyl)-2-Fluorophenylalanine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.

