CAS 1339374-36-5

1-[(5-Thiazolylmethyl)amino]-2-propanol

Description:

1-[(5-Thiazolylmethyl)amino]-2-propanol is a chemical compound characterized by its unique structure, which includes a thiazole ring and an amino alcohol functional group. The thiazole moiety contributes to its potential biological activity, often associated with various pharmacological properties. This compound typically appears as a solid or crystalline substance, and its solubility can vary depending on the solvent used, often being soluble in polar solvents due to the presence of the hydroxyl group. The amino alcohol structure suggests that it may participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. Additionally, the presence of the thiazole ring may impart specific electronic properties, making it of interest in medicinal chemistry and drug development. The compound's molecular weight, melting point, and other physical properties would be essential for practical applications, including formulation in pharmaceuticals or as a research chemical. Overall, 1-[(5-Thiazolylmethyl)amino]-2-propanol represents a versatile compound with potential utility in various chemical and biological contexts.

Formula: C₇H₁₂N₂OS

InChI: InChI=1S/C7H12N2OS/c1-6(10)2-8-3-7-4-9-5-11-7/h4-6,8,10H,2-3H2,1H3

InChI key: InChIKey=JTQLJTIBVODQJW-UHFFFAOYSA-N

SMILES: C(NCC(C)O)C1=CN=CS1

Synonyms:

• 2-Propanol, 1-[(5-thiazolylmethyl)amino]-
• 1-[(5-Thiazolylmethyl)amino]-2-propanol