CAS 1339375-57-3

4-[(3-Bromophenyl)thio]-2-chloropyridine

Description:

4-[(3-Bromophenyl)thio]-2-chloropyridine is a chemical compound characterized by its unique structure, which includes a pyridine ring substituted with a chlorine atom and a thioether group linked to a bromophenyl moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the halogen and sulfur atoms. The bromophenyl group can enhance the compound's lipophilicity, potentially influencing its biological activity and solubility in organic solvents. The chlorine atom introduces additional electronegativity, which can affect the compound's electronic properties and reactivity. Such compounds are often of interest in medicinal chemistry and material science due to their potential applications in pharmaceuticals and as intermediates in organic synthesis. The presence of both sulfur and halogen functionalities may also impart unique characteristics, such as increased reactivity in nucleophilic substitution reactions. Overall, 4-[(3-Bromophenyl)thio]-2-chloropyridine is a versatile compound with significant implications in various chemical research fields.

Formula: C₁₁H₇BrClNS

InChI: InChI=1S/C11H7BrClNS/c12-8-2-1-3-9(6-8)15-10-4-5-14-11(13)7-10/h1-7H

InChI key: InChIKey=PGQCRJNGKZOFFB-UHFFFAOYSA-N

SMILES: S(C1=CC(Br)=CC=C1)C=2C=C(Cl)N=CC2

Synonyms:

• 4-[(3-Bromophenyl)thio]-2-chloropyridine
• Pyridine, 4-[(3-bromophenyl)thio]-2-chloro-