CAS 133941-26-1

Bis(trimethylsilylmethyl)dimethoxysilane

Description:

Bis(trimethylsilylmethyl)dimethoxysilane, identified by its CAS number 133941-26-1, is an organosilicon compound characterized by its unique structure that includes two trimethylsilylmethyl groups and two methoxy groups attached to a silicon atom. This compound is typically a colorless to pale yellow liquid with a relatively low viscosity. It exhibits good thermal stability and is soluble in organic solvents, making it useful in various applications, particularly in the field of materials science and surface modification. The presence of methoxy groups allows for potential reactivity with moisture, leading to the formation of silanol groups upon hydrolysis, which can facilitate bonding to substrates. Its trimethylsilyl groups contribute to hydrophobic properties, enhancing water repellency in treated surfaces. Additionally, this compound can serve as a coupling agent or a precursor in the synthesis of siloxane polymers, contributing to the development of advanced materials with tailored properties. Overall, its versatility makes it valuable in coatings, adhesives, and sealants.

Formula: C₁₀H₂₈O₂Si₃

InChI: InChI=1/C10H28O2Si3/c1-11-15(12-2,9-13(3,4)5)10-14(6,7)8/h9-10H2,1-8H3

SMILES: CO[Si](C[Si](C)(C)C)(C[Si](C)(C)C)OC

Synonyms:

• Bistrimethylsilylmethyldimethoxysilane
• [(Dimethoxysilanediyl)Dimethanediyl]Bis(Trimethylsilane)

Dimethoxybis[(trimethylsilyl)methyl]silane

CAS: 133941-26-1

Formula: C₁₀H₂₈O₂Si₃

Molecular weight: 264.59

Ref: 4Z-S-225008