CAS 13395-63-6
:(3,5-dichlorophenyl)-(p-tolyl)methanone
Description:
(3,5-Dichlorophenyl)-(p-tolyl)methanone, with the CAS number 13395-63-6, is an organic compound characterized by its structure, which features a ketone functional group attached to a dichlorophenyl group and a p-tolyl group. This compound typically appears as a solid at room temperature and is known for its aromatic properties due to the presence of the phenyl rings. The dichlorophenyl moiety contributes to its potential reactivity and biological activity, as halogenated compounds often exhibit unique interactions in chemical reactions and biological systems. The presence of the methyl group in the p-tolyl part can influence the compound's solubility and stability. In terms of applications, such compounds may be explored in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. Safety data should be consulted for handling and storage, as halogenated compounds can pose environmental and health risks. Overall, (3,5-dichlorophenyl)-(p-tolyl)methanone is a notable compound in organic chemistry with potential applications in various fields.
Formula:C14H10Cl2O
InChI:InChI=1/C14H10Cl2O/c1-9-2-4-10(5-3-9)14(17)11-6-12(15)8-13(16)7-11/h2-8H,1H3
SMILES:Cc1ccc(cc1)C(=O)c1cc(cc(c1)Cl)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.