CAS 13395-65-8
:(4-chlorophenyl)(3,5-dichlorophenyl)methanone
Description:
(4-chlorophenyl)(3,5-dichlorophenyl)methanone, also known by its CAS number 13395-65-8, is an organic compound characterized by its ketone functional group and the presence of multiple chlorine substituents on its phenyl rings. This compound features a central carbonyl group (C=O) bonded to two distinct chlorinated phenyl groups, which contribute to its chemical properties and reactivity. The presence of chlorine atoms enhances the compound's lipophilicity and can influence its biological activity, making it of interest in various fields, including pharmaceuticals and agrochemicals. The molecular structure suggests potential applications in synthesis and as an intermediate in organic reactions. Additionally, the compound may exhibit specific physical properties such as solubility in organic solvents and varying melting or boiling points, influenced by its molecular weight and the steric effects of the chlorine substituents. Safety and handling considerations are essential due to the potential toxicity associated with chlorinated compounds. Overall, (4-chlorophenyl)(3,5-dichlorophenyl)methanone is a notable compound in organic chemistry with diverse implications.
Formula:C13H7Cl3O
InChI:InChI=1/C13H7Cl3O/c14-10-3-1-8(2-4-10)13(17)9-5-11(15)7-12(16)6-9/h1-7H
SMILES:c1cc(ccc1C(=O)c1cc(cc(c1)Cl)Cl)Cl
Synonyms:- Methanone, (4-chlorophenyl)(3,5-dichlorophenyl)-
- (4-Chlorophenyl)(3,5-dichlorophenyl)methanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.