CAS 133950-72-8
:6-Chloro-1H-indol-3-yl nonanoate
Description:
6-Chloro-1H-indol-3-yl nonanoate is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a chlorine atom at the 6-position of the indole ring introduces a halogen substituent, which can influence the compound's reactivity and biological activity. The nonanoate moiety, derived from nonanoic acid, contributes to the compound's hydrophobic characteristics, potentially affecting its solubility and membrane permeability. This compound may exhibit various biological activities, making it of interest in medicinal chemistry and pharmacology. Its specific properties, such as melting point, boiling point, and spectral characteristics, would depend on its molecular interactions and the environment in which it is studied. As with many indole derivatives, it may also participate in various chemical reactions, including electrophilic substitutions and nucleophilic attacks, due to the electron-rich nature of the indole nitrogen. Overall, 6-Chloro-1H-indol-3-yl nonanoate represents a unique structure with potential applications in research and development.
Formula:C17H22ClNO2
InChI:InChI=1S/C17H22ClNO2/c1-2-3-4-5-6-7-8-17(20)21-16-12-19-15-11-13(18)9-10-14(15)16/h9-12,19H,2-8H2,1H3
InChI key:InChIKey=STALAAUKINVVQO-UHFFFAOYSA-N
SMILES:O(C(CCCCCCCC)=O)C=1C=2C(NC1)=CC(Cl)=CC2
Synonyms:- 5-Chloro-3-indolyl nonanoate
- 6-Chloro-1H-indol-3-yl nonanoate
- Nonanoic acid, 6-chloro-1H-indol-3-yl ester
- Rarechem Ah Bs 0033
- Salmon(Tm)-Nonanoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
6-Chloro-3-indoxyl nonanoate
CAS:<p>6-Chloro-3-indoxyl nonanoate is a fluorescent substrate that is used in the detection of beta-galactosidase activity. It has been used to detect the enzyme levels in various culture media and as a high quality, food testing, and environmental testing. The product is also used as a ligand for enzyme inhibition studies. 6-Chloro-3-indoxyl nonanoate has shown to be an excellent fluoroquinolone substrate for chemiluminescence assays. This product is CAS No. 133950-72-8 and is of high purity and high quality.</p>Purity:Min. 95%Molecular weight:307.81 g/mol6-Chloro-3-indoxyl nonanoate
CAS:<p>Chromogenic substrate for esterase with C9 activity yielding a salmon colored precipitate upon cleavage.</p>Formula:C17H22ClNO2Purity:Min. 98 Area-%Molecular weight:307.82 g/mol
