CAS 13396-80-0

9-Phosphabicyclo[4.2.1]nonane

Description:

9-Phosphabicyclo[4.2.1]nonane is a bicyclic compound that incorporates a phosphorus atom into its structure, replacing one of the carbon atoms in a bicyclic framework. This unique arrangement contributes to its distinctive chemical properties. The compound features a nonane backbone, which consists of nine total atoms, including the phosphorus atom, and is characterized by its rigid bicyclic structure. The presence of phosphorus introduces potential reactivity, particularly in coordination chemistry and organophosphorus chemistry. This compound may exhibit interesting electronic properties due to the presence of the phosphorus atom, which can participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. Additionally, 9-phosphabicyclo[4.2.1]nonane may have applications in organic synthesis and materials science, particularly in the development of phosphine ligands or as intermediates in the synthesis of more complex molecules. Its unique structure and properties make it a subject of interest in both theoretical and applied chemistry.

Formula: C₈H₁₅P

InChI: InChI=1S/C8H15P/c1-2-4-8-6-5-7(3-1)9-8/h7-9H,1-6H2

InChI key: InChIKey=RTWRUXIOIPQRRE-UHFFFAOYSA-N

SMILES: C12PC(CC1)CCCC2

Synonyms:

• 9-Phosphabicyclo[4.2.1]nonane
• 9-Phosphabicyclo(4.2.1)nonane
• 9H-9-Phosphabicyclo[4.2.1]nonane