CAS 1339699-58-9
:3-(4H-1,2,4-Triazol-4-yl)piperidine
Description:
3-(4H-1,2,4-Triazol-4-yl)piperidine is a chemical compound characterized by its unique structure, which includes a piperidine ring and a 4H-1,2,4-triazole moiety. The piperidine ring is a six-membered saturated nitrogen-containing heterocycle, while the triazole is a five-membered ring containing three nitrogen atoms. This compound is often studied for its potential biological activities, including antimicrobial and antifungal properties, due to the presence of the triazole group, which is known for its ability to interact with biological targets. The presence of the piperidine ring may enhance its lipophilicity and facilitate membrane permeability, making it a candidate for drug development. Additionally, the compound's solubility, stability, and reactivity can be influenced by the functional groups attached to the rings. Overall, 3-(4H-1,2,4-Triazol-4-yl)piperidine represents a class of compounds that may have significant applications in medicinal chemistry and pharmacology.
Formula:C7H12N4
InChI:InChI=1S/C7H12N4/c1-2-7(4-8-3-1)11-5-9-10-6-11/h5-8H,1-4H2
InChI key:InChIKey=PSZLCXKDXBQGGD-UHFFFAOYSA-N
SMILES:N1(C=NN=C1)C2CCCNC2
Synonyms:- Piperidine, 3-(4H-1,2,4-triazol-4-yl)-
- 3-(4H-1,2,4-Triazol-4-yl)piperidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.