
CAS 133972-64-2
:Methyl 2-(phenylamino)-5-thiazolecarboxylate
Description:
Methyl 2-(phenylamino)-5-thiazolecarboxylate, identified by its CAS number 133972-64-2, is an organic compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. This compound features a methyl ester functional group, contributing to its solubility in organic solvents. The presence of the phenylamino group indicates that it has an aromatic amine structure, which can influence its reactivity and potential applications in pharmaceuticals or agrochemicals. The thiazole moiety is known for its biological activity, often serving as a scaffold in drug design. Methyl 2-(phenylamino)-5-thiazolecarboxylate may exhibit properties such as moderate to high stability under standard conditions, and its reactivity can be influenced by the substituents on the thiazole and phenyl groups. Overall, this compound's unique structural features suggest potential utility in various chemical and biological applications, warranting further investigation into its properties and uses.
Formula:C11H10N2O2S
InChI:InChI=1S/C11H10N2O2S/c1-15-10(14)9-7-12-11(16-9)13-8-5-3-2-4-6-8/h2-7H,1H3,(H,12,13)
InChI key:InChIKey=DWTBCNWPZJVLAP-UHFFFAOYSA-N
SMILES:N(C=1SC(C(OC)=O)=CN1)C2=CC=CC=C2
Synonyms:- 5-Thiazolecarboxylic acid, 2-(phenylamino)-, methyl ester
- Methyl 2-(phenylamino)-5-thiazolecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.